Structure of PDB 5fxr Chain A Binding Site BS01 |
|
|
Ligand ID | 8LN |
InChI | InChI=1S/C20H21ClN8/c1-13-16(12-29(27-13)14-5-7-22-8-6-14)25-20-24-10-15(21)19(26-20)17-11-23-18-4-2-3-9-28(17)18/h2-4,9-12,14,22H,5-8H2,1H3,(H,24,25,26) |
InChIKey | JVFLXTNKVBOVBS-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | Cc1c(cn(n1)C2CCNCC2)Nc3ncc(c(n3)c4cnc5n4cccc5)Cl | CACTVS 3.385 | Cc1nn(cc1Nc2ncc(Cl)c(n2)c3cnc4ccccn34)C5CCNCC5 |
|
Formula | C20 H21 Cl N8 |
Name | 5-chloranyl-4-imidazo[1,2-a]pyridin-3-yl-N-(3-methyl-1-piperidin-4-yl-pyrazol-4-yl)pyrimidin-2-amine |
ChEMBL | CHEMBL3823007 |
DrugBank | |
ZINC | ZINC000584905497
|
PDB chain | 5fxr Chain A Residue 2284
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|