Structure of PDB 5fto Chain A Binding Site BS01 |
|
|
Ligand ID | YMX |
InChI | InChI=1S/C31H34F2N6O2/c1-38-8-10-39(11-9-38)25-3-4-26(29(19-25)34-24-6-12-41-13-7-24)31(40)35-30-27-17-20(2-5-28(27)36-37-30)14-21-15-22(32)18-23(33)16-21/h2-5,15-19,24,34H,6-14H2,1H3,(H2,35,36,37,40) |
InChIKey | HAYYBYPASCDWEQ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CN1CCN(CC1)c2ccc(c(c2)NC3CCOCC3)C(=O)Nc4c5cc(ccc5[nH]n4)Cc6cc(cc(c6)F)F | CACTVS 3.385 | CN1CCN(CC1)c2ccc(C(=O)Nc3n[nH]c4ccc(Cc5cc(F)cc(F)c5)cc34)c(NC6CCOCC6)c2 | ACDLabs 12.01 | c6c4N=N\C(=N\C(=O)c2ccc(N1CCN(C)CC1)cc2NC3CCOCC3)c4cc(Cc5cc(F)cc(F)c5)c6 |
|
Formula | C31 H34 F2 N6 O2 |
Name | Entrectinib |
ChEMBL | CHEMBL1983268 |
DrugBank | DB11986 |
ZINC | ZINC000043204146
|
PDB chain | 5fto Chain A Residue 2402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|