Structure of PDB 5fri Chain A Binding Site BS01 |
|
|
Ligand ID | ZUQ |
InChI | InChI=1S/C15H13ClN4O3/c16-10-6-18-15-13(22-7-23-15)12(10)19-9-3-4-17-11(5-9)20-14(21)8-1-2-8/h3-6,8H,1-2,7H2,(H2,17,18,19,20,21) |
InChIKey | WJASKODGMHBDFO-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1cnc(cc1Nc2c(cnc3c2OCO3)Cl)NC(=O)C4CC4 | CACTVS 3.385 | Clc1cnc2OCOc2c1Nc3ccnc(NC(=O)C4CC4)c3 |
|
Formula | C15 H13 Cl N4 O3 |
Name | N-[4-[(6-chloro-[1,3]dioxolo[4,5-b]pyridin-7-yl)amino]-2-pyridyl]cyclopropanecarboxamide |
ChEMBL | CHEMBL3818173 |
DrugBank | |
ZINC | ZINC000584905725
|
PDB chain | 5fri Chain A Residue 1501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|