Structure of PDB 5fns Chain A Binding Site BS01 |
|
|
Ligand ID | XYY |
InChI | InChI=1S/C19H21ClN4O4S/c1-23(29(3,27)28)11-14-8-12(4-6-16(14)20)15(10-19(25)26)13-5-7-18-17(9-13)21-22-24(18)2/h4-9,15H,10-11H2,1-3H3,(H,25,26)/t15-/m0/s1 |
InChIKey | USDLDJOPUXHGLC-HNNXBMFYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CN(Cc1cc(ccc1Cl)[CH](CC(O)=O)c2ccc3n(C)nnc3c2)[S](C)(=O)=O | CACTVS 3.385 | CN(Cc1cc(ccc1Cl)[C@H](CC(O)=O)c2ccc3n(C)nnc3c2)[S](C)(=O)=O | OpenEye OEToolkits 1.7.6 | Cn1c2ccc(cc2nn1)C(CC(=O)O)c3ccc(c(c3)CN(C)S(=O)(=O)C)Cl | OpenEye OEToolkits 1.7.6 | Cn1c2ccc(cc2nn1)[C@@H](CC(=O)O)c3ccc(c(c3)CN(C)S(=O)(=O)C)Cl |
|
Formula | C19 H21 Cl N4 O4 S |
Name | (3s)-{4-Chloro-3-[(N-methylmethanesulfonamido) methyl]phenyl}-3-(1-methyl-1H-1,2,3-benzotriazol-5-yl) propanoic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584905756
|
PDB chain | 5fns Chain A Residue 1614
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|