Structure of PDB 5fhm Chain A Binding Site BS01 |
|
|
Ligand ID | 5XP |
InChI | InChI=1S/C15H17N7O4/c16-6-8-2-1-3-9(4-8)7-22-19-13(18-21-22)12-10(14(23)20-26-12)5-11(17)15(24)25/h1-4,11H,5-7,16-17H2,(H,20,23)(H,24,25)/t11-/m0/s1 |
InChIKey | RVAKWTBISFVYTO-NSHDSACASA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | NCc1cccc(Cn2nnc(n2)c3onc(O)c3C[C@H](N)C(O)=O)c1 | OpenEye OEToolkits 2.0.4 | c1cc(cc(c1)Cn2nc(nn2)c3c(c(no3)O)CC(C(=O)O)N)CN | OpenEye OEToolkits 2.0.4 | c1cc(cc(c1)Cn2nc(nn2)c3c(c(no3)O)C[C@@H](C(=O)O)N)CN | CACTVS 3.385 | NCc1cccc(Cn2nnc(n2)c3onc(O)c3C[CH](N)C(O)=O)c1 |
|
Formula | C15 H17 N7 O4 |
Name | (2~{S})-3-[5-[2-[[3-(aminomethyl)phenyl]methyl]-1,2,3,4-tetrazol-5-yl]-3-oxidanyl-1,2-oxazol-4-yl]-2-azanyl-propanoic acid |
ChEMBL | CHEMBL3786901 |
DrugBank | |
ZINC | ZINC000584905307
|
PDB chain | 5fhm Chain A Residue 304
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|