Structure of PDB 5feq Chain A Binding Site BS01 |
|
|
|
| Ligand ID | 5XH |
| InChI | InChI=1S/C27H34N6O2/c1-19-9-7-11-23-25(19)33(27(29-23)30-26(35)21-13-14-28-20(2)17-21)22-10-5-6-16-32(18-22)24(34)12-8-15-31(3)4/h7-9,11-14,17,22H,5-6,10,15-16,18H2,1-4H3,(H,29,30,35)/b12-8+/t22-/m1/s1 |
| InChIKey | SKLAQDNYYXAFGK-QWDXWUACSA-N |
| SMILES | | Software | SMILES |
|---|
| OpenEye OEToolkits 2.0.4 | Cc1cccc2c1n(c(n2)NC(=O)c3ccnc(c3)C)C4CCCCN(C4)C(=O)C=CCN(C)C | | OpenEye OEToolkits 2.0.4 | Cc1cccc2c1n(c(n2)NC(=O)c3ccnc(c3)C)[C@@H]4CCCCN(C4)C(=O)C=CCN(C)C | | CACTVS 3.385 | CN(C)C/C=C/C(=O)N1CCCC[C@H](C1)n2c(NC(=O)c3ccnc(C)c3)nc4cccc(C)c24 | | CACTVS 3.385 | CN(C)CC=CC(=O)N1CCCC[CH](C1)n2c(NC(=O)c3ccnc(C)c3)nc4cccc(C)c24 |
|
| Formula | C27 H34 N6 O2 |
| Name | ~{N}-[1-[(3~{R})-1-[4-(dimethylamino)but-2-enoyl]azepan-3-yl]-7-methyl-benzimidazol-2-yl]-2-methyl-pyridine-4-carboxamide |
| ChEMBL | CHEMBL3960167 |
| DrugBank | |
| ZINC | ZINC000210619361
|
| PDB chain | 5feq Chain A Residue 1101
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
| Global view | Local view | Structure summary |
[Spin on]
[Spin off]
[Reset]
[High quality]
[Low quality]
[White background]
[Black background]
|
[Spin on]
[Spin off]
[Reset]
[High quality]
[Low quality]
[White background]
[Black background]
|
| PDB | 5feq Discovery of (R,E)-N-(7-Chloro-1-(1-[4-(dimethylamino)but-2-enoyl]azepan-3-yl)-1H-benzo[d]imidazol-2-yl)-2-methylisonicotinamide (EGF816), a Novel, Potent, and WT Sparing Covalent Inhibitor of Oncogenic (L858R, ex19del) and Resistant (T790M) EGFR Mutants for the Treatment of EGFR Mutant Non-Small-Cell Lung Cancers. |
| Resolution | 3.4 Å |
Binding residue
(original residue number in PDB) | L718 F723 V726 A743 M790 Q791 M793 P794 G796 C797 D800 L844 |
Binding residue
(residue number reindexed from 1) | L22 F27 V30 A47 M89 Q90 M92 P93 G95 C96 D99 L143 |
| Annotation score | 1  |
| Binding affinity | BindingDB: IC50=68nM |
|
|
|
|
|
|
|
|
