Structure of PDB 5f4n Chain A Binding Site BS01 |
|
|
Ligand ID | 5UY |
InChI | InChI=1S/C17H19N7O3/c1-26-17(25)13-9-23-15(24-16-10-20-11(5-18)6-22-16)4-14(13)21-8-12-7-19-2-3-27-12/h4,6,9-10,12,19H,2-3,7-8H2,1H3,(H2,21,22,23,24)/t12-/m1/s1 |
InChIKey | PHPWNBVMNTWSJB-GFCCVEGCSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COC(=O)c1cnc(Nc2cnc(cn2)C#N)cc1NC[C@H]3CNCCO3 | OpenEye OEToolkits 2.0.4 | COC(=O)c1cnc(cc1NCC2CNCCO2)Nc3cnc(cn3)C#N | OpenEye OEToolkits 2.0.4 | COC(=O)c1cnc(cc1NC[C@H]2CNCCO2)Nc3cnc(cn3)C#N | CACTVS 3.385 | COC(=O)c1cnc(Nc2cnc(cn2)C#N)cc1NC[CH]3CNCCO3 |
|
Formula | C17 H19 N7 O3 |
Name | methyl 6-[(5-cyanopyrazin-2-yl)amino]-4-[[(2~{R})-morpholin-2-yl]methylamino]pyridine-3-carboxylate |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098178698
|
PDB chain | 5f4n Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|