Structure of PDB 5es1 Chain A Binding Site BS01 |
|
|
Ligand ID | 5RC |
InChI | InChI=1S/C20H20F5N5OS/c1-2-14-11(12-8-28-30-9-10(20(23,24)25)7-27-17(12)30)6-15(32-14)18(31)29-16-13(26)4-3-5-19(16,21)22/h6-9,13,16H,2-5,26H2,1H3,(H,29,31)/t13-,16-/m1/s1 |
InChIKey | QXXZIVGTJXYLQO-CZUORRHYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.4 | CCc1c(cc(s1)C(=O)NC2C(CCCC2(F)F)N)c3cnn4c3ncc(c4)C(F)(F)F | CACTVS 3.385 | CCc1sc(cc1c2cnn3cc(cnc23)C(F)(F)F)C(=O)N[CH]4[CH](N)CCCC4(F)F | CACTVS 3.385 | CCc1sc(cc1c2cnn3cc(cnc23)C(F)(F)F)C(=O)N[C@@H]4[C@H](N)CCCC4(F)F | OpenEye OEToolkits 2.0.4 | CCc1c(cc(s1)C(=O)N[C@@H]2[C@@H](CCCC2(F)F)N)c3cnn4c3ncc(c4)C(F)(F)F |
|
Formula | C20 H20 F5 N5 O S |
Name | ~{N}-[(1~{R},6~{R})-6-azanyl-2,2-bis(fluoranyl)cyclohexyl]-5-ethyl-4-[6-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-3-yl]thiophene-2-carboxamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000146732244
|
PDB chain | 5es1 Chain A Residue 4000
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|