Structure of PDB 5ep3 Chain A Binding Site BS01 |
|
|
Ligand ID | 5QT |
InChI | InChI=1S/C10H16N4O3S/c1-10(2,3)5-17-6(15)4-11-7-8(18)12-9(16)14-13-7/h4-5H2,1-3H3,(H,11,13)(H2,12,14,16,18) |
InChIKey | REFYLRHEWINELP-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 OpenEye OEToolkits 2.0.4 | CC(C)(C)COC(=O)CNC1=NNC(=O)NC1=S |
|
Formula | C10 H16 N4 O3 S |
Name | 2,2-dimethylpropyl 2-[(3-oxidanylidene-5-sulfanylidene-2~{H}-1,2,4-triazin-6-yl)amino]ethanoate |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584905306
|
PDB chain | 5ep3 Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|