Structure of PDB 5eol Chain A Binding Site BS01 |
|
|
Ligand ID | 5QO |
InChI | InChI=1S/C21H21N5O/c1-11-5-3-6-13-10-22-21(27)15-9-17(25-18(13)15)14-7-4-8-16-19(14)26-20(23-11)12(2)24-16/h3-5,7-9,11,13,25H,6,10H2,1-2H3,(H,22,27)(H,23,26)/b5-3-/t11-,13+/m1/s1 |
InChIKey | DDQXBYGNFGPJRL-CLZWFORCSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[C@H]\1Nc2nc3c(cccc3c4[nH]c5[C@H](CNC(=O)c5c4)C\C=C\1)nc2C | CACTVS 3.385 | C[CH]1Nc2nc3c(cccc3c4[nH]c5[CH](CNC(=O)c5c4)CC=C1)nc2C | OpenEye OEToolkits 2.0.4 | Cc1c2nc3c(cccc3n1)-c4cc5c([nH]4)[C@@H](C/C=C\[C@H](N2)C)CNC5=O | OpenEye OEToolkits 2.0.4 | Cc1c2nc3c(cccc3n1)-c4cc5c([nH]4)C(CC=CC(N2)C)CNC5=O |
|
Formula | C21 H21 N5 O |
Name | macrocyclic quinoxaline-pyrrolodihydropiperidinone |
ChEMBL | CHEMBL3809691 |
DrugBank | |
ZINC | ZINC000150057420
|
PDB chain | 5eol Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|