Structure of PDB 5ee7 Chain A Binding Site BS01 |
|
|
Ligand ID | 5MV |
InChI | InChI=1S/C32H27Cl2N3O4/c1-19(20-3-5-21(6-4-20)32(40)35-12-11-31(38)39)37-30(18-29(36-37)25-14-26(33)17-27(34)15-25)24-8-7-23-16-28(41-2)10-9-22(23)13-24/h3-10,13-19H,11-12H2,1-2H3,(H,35,40)(H,38,39)/t19-/m0/s1 |
InChIKey | DNTVJEMGHBIUMW-IBGZPJMESA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COc1ccc2cc(ccc2c1)c3cc(nn3[C@@H](C)c4ccc(cc4)C(=O)NCCC(O)=O)c5cc(Cl)cc(Cl)c5 | OpenEye OEToolkits 2.0.4 | CC(c1ccc(cc1)C(=O)NCCC(=O)O)n2c(cc(n2)c3cc(cc(c3)Cl)Cl)c4ccc5cc(ccc5c4)OC | OpenEye OEToolkits 2.0.4 | C[C@@H](c1ccc(cc1)C(=O)NCCC(=O)O)n2c(cc(n2)c3cc(cc(c3)Cl)Cl)c4ccc5cc(ccc5c4)OC | CACTVS 3.385 | COc1ccc2cc(ccc2c1)c3cc(nn3[CH](C)c4ccc(cc4)C(=O)NCCC(O)=O)c5cc(Cl)cc(Cl)c5 |
|
Formula | C32 H27 Cl2 N3 O4 |
Name | 3-[[4-[(1~{S})-1-[3-[3,5-bis(chloranyl)phenyl]-5-(6-methoxynaphthalen-2-yl)pyrazol-1-yl]ethyl]phenyl]carbonylamino]propanoic acid |
ChEMBL | CHEMBL1933349 |
DrugBank | DB12044 |
ZINC | ZINC000068250425
|
PDB chain | 5ee7 Chain A Residue 1201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
E1009 D1018 |
Catalytic site (residue number reindexed from 1) |
E117 D126 |
Enzyme Commision number |
3.2.1.17: lysozyme. |
|
|
|