Structure of PDB 5edr Chain A Binding Site BS01 |
|
|
Ligand ID | 5N4 |
InChI | InChI=1S/C19H19N7O/c1-19(2)15-12(10-27-19)16(23-18(21-15)14-8-9-20-26(14)3)22-17-11-6-4-5-7-13(11)24-25-17/h4-9H,10H2,1-3H3,(H2,21,22,23,24,25) |
InChIKey | HMWMAHXTIWOHMD-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cn1nccc1c2nc(Nc3n[nH]c4ccccc34)c5COC(C)(C)c5n2 | OpenEye OEToolkits 2.0.4 | CC1(c2c(c(nc(n2)c3ccnn3C)Nc4c5ccccc5[nH]n4)CO1)C |
|
Formula | C19 H19 N7 O |
Name | ~{N}-(1~{H}-indazol-3-yl)-7,7-dimethyl-2-(2-methylpyrazol-3-yl)-5~{H}-furo[3,4-d]pyrimidin-4-amine |
ChEMBL | CHEMBL3759096 |
DrugBank | |
ZINC | ZINC000263620516
|
PDB chain | 5edr Chain A Residue 1101
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|