Structure of PDB 5e91 Chain A Binding Site BS01 |
|
|
Ligand ID | 5L4 |
InChI | InChI=1S/C22H24N6O3/c23-21-20(26-17(14-25-21)16-3-1-15(2-4-16)6-10-29)22(30)27-18-13-24-7-5-19(18)28-8-11-31-12-9-28/h1-5,7,13-14,29H,6,8-12H2,(H2,23,25)(H,27,30) |
InChIKey | UEECNVFACUZGKV-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 OpenEye OEToolkits 1.9.2 | c1cc(ccc1CCO)c2cnc(c(n2)C(=O)Nc3cnccc3N4CCOCC4)N | CACTVS 3.385 | Nc1ncc(nc1C(=O)Nc2cnccc2N3CCOCC3)c4ccc(CCO)cc4 |
|
Formula | C22 H24 N6 O3 |
Name | 3-amino-6-[4-(2-hydroxyethyl)phenyl]-N-[4-(morpholin-4-yl)pyridin-3-yl]pyrazine-2-carboxamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584904935
|
PDB chain | 5e91 Chain A Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|