Structure of PDB 5e5i Chain A Binding Site BS01 |
|
|
Ligand ID | 5NJ |
InChI | InChI=1S/C13H18NO8P/c1-8-13(18)11(4-2-10(15)3-5-12(16)17)9(6-14-8)7-22-23(19,20)21/h6,18H,2-5,7H2,1H3,(H,16,17)(H2,19,20,21) |
InChIKey | QNTFLQLZXLXUGE-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.4 | Cc1c(c(c(cn1)COP(=O)(O)O)CCC(=O)CCC(=O)O)O | CACTVS 3.385 | Cc1ncc(CO[P](O)(O)=O)c(CCC(=O)CCC(O)=O)c1O |
|
Formula | C13 H18 N O8 P |
Name | 6-[2-methyl-3-oxidanyl-5-(phosphonooxymethyl)pyridin-4-yl]-4-oxidanylidene-hexanoic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584904854
|
PDB chain | 5e5i Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|