Structure of PDB 5e3g Chain A Binding Site BS01 |
|
|
Ligand ID | 5JQ |
InChI | InChI=1S/C5H4N4O2S/c10-3-1-2(7-4(11)6-1)8-5(12)9-3/h(H4,6,7,8,9,10,11,12) |
InChIKey | JDAXHCJXSLHZAG-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | C12=C(NC(=O)N1)NC(=S)NC2=O | CACTVS 3.385 | O=C1NC2=C(N1)C(=O)NC(=S)N2 | ACDLabs 12.01 | C2=1NC(NC=1C(NC(N2)=S)=O)=O |
|
Formula | C5 H4 N4 O2 S |
Name | 2-thioxo-2,3,7,9-tetrahydro-1H-purine-6,8-dione |
ChEMBL | CHEMBL3818787 |
DrugBank | |
ZINC | ZINC000018145973
|
PDB chain | 5e3g Chain A Residue 801
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|