Structure of PDB 5e3d Chain A Binding Site BS01 |
|
|
Ligand ID | 5JL |
InChI | InChI=1S/C5H4N4OS2/c10-3-1-2(7-4(11)6-1)8-5(12)9-3/h(H4,6,7,8,9,10,11,12) |
InChIKey | NDSUZZIWNBVBKW-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | C2=1NC(NC=1C(NC(N2)=S)=O)=S | CACTVS 3.385 | O=C1NC(=S)NC2=C1NC(=S)N2 | OpenEye OEToolkits 1.9.2 | C12=C(NC(=S)N1)NC(=S)NC2=O |
|
Formula | C5 H4 N4 O S2 |
Name | 2,8-dithioxo-1,2,3,7,8,9-hexahydro-6H-purin-6-one |
ChEMBL | CHEMBL1416049 |
DrugBank | |
ZINC | ZINC000017284313
|
PDB chain | 5e3d Chain A Residue 801
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|