Structure of PDB 5e1e Chain A Binding Site BS01 |
|
|
Ligand ID | 5JG |
InChI | InChI=1S/C20H23ClFN5O2/c1-28-15-7-12(14(22)8-16(15)29-2)19-26-18-17(13(21)10-25-20(18)27-19)24-9-11-3-5-23-6-4-11/h7-8,10-11,23H,3-6,9H2,1-2H3,(H2,24,25,26,27) |
InChIKey | IRGAIDAWHGYOKD-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COc1cc(F)c(cc1OC)c2[nH]c3ncc(Cl)c(NCC4CCNCC4)c3n2 | OpenEye OEToolkits 1.9.2 | COc1cc(c(cc1OC)F)c2[nH]c3c(n2)c(c(cn3)Cl)NCC4CCNCC4 | ACDLabs 12.01 | COc4c(cc(c(c1nc2c(n1)ncc(c2NCC3CCNCC3)Cl)c4)F)OC |
|
Formula | C20 H23 Cl F N5 O2 |
Name | 6-chloro-2-(2-fluoro-4,5-dimethoxyphenyl)-N-(piperidin-4-ylmethyl)-3H-imidazo[4,5-b]pyridin-7-amine |
ChEMBL | CHEMBL3746463 |
DrugBank | |
ZINC | ZINC000263620567
|
PDB chain | 5e1e Chain A Residue 1202
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|