Structure of PDB 5dya Chain A Binding Site BS01 |
|
|
Ligand ID | 5GV |
InChI | InChI=1S/C11H12N2O3/c1-2-7-10(14)13-9-5-6(11(15)16)3-4-8(9)12-7/h3-5,7,12H,2H2,1H3,(H,13,14)(H,15,16)/t7-/m1/s1 |
InChIKey | RSQRDVPENVGBIX-SSDOTTSWSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C1C(Nc2c(N1)cc(cc2)C(O)=O)CC | OpenEye OEToolkits 1.9.2 | CC[C@@H]1C(=O)Nc2cc(ccc2N1)C(=O)O | OpenEye OEToolkits 1.9.2 | CCC1C(=O)Nc2cc(ccc2N1)C(=O)O | CACTVS 3.385 | CC[C@H]1Nc2ccc(cc2NC1=O)C(O)=O | CACTVS 3.385 | CC[CH]1Nc2ccc(cc2NC1=O)C(O)=O |
|
Formula | C11 H12 N2 O3 |
Name | (2R)-2-ethyl-3-oxo-1,2,3,4-tetrahydroquinoxaline-6-carboxylic acid |
ChEMBL | CHEMBL3819225 |
DrugBank | |
ZINC | ZINC000035411550
|
PDB chain | 5dya Chain A Residue 802
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|