Structure of PDB 5duf Chain A Binding Site BS01 |
|
|
Ligand ID | G7A |
InChI | InChI=1S/C16H16F3N3O2/c1-2-9-3-5-10(6-4-9)12-7-13(16(17,18)19)22-14(21-12)11(8-20-22)15(23)24/h3-6,8,12-13,21H,2,7H2,1H3,(H,23,24)/t12-,13+/m1/s1 |
InChIKey | PZUHMVXZBLEHFM-OLZOCXBDSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | CCc1ccc(cc1)[C@H]2C[C@H](n3c(c(cn3)C(=O)O)N2)C(F)(F)F | CACTVS 3.385 | CCc1ccc(cc1)[C@H]2C[C@H](n3ncc(C(O)=O)c3N2)C(F)(F)F | OpenEye OEToolkits 1.9.2 | CCc1ccc(cc1)C2CC(n3c(c(cn3)C(=O)O)N2)C(F)(F)F | ACDLabs 12.01 | O=C(O)c1cnn3c1NC(c2ccc(CC)cc2)CC3C(F)(F)F | CACTVS 3.385 | CCc1ccc(cc1)[CH]2C[CH](n3ncc(C(O)=O)c3N2)C(F)(F)F |
|
Formula | C16 H16 F3 N3 O2 |
Name | (5R,7S)-5-(4-ethylphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000142782028
|
PDB chain | 5duf Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|