Structure of PDB 5dq1 Chain A Binding Site BS01 |
|
|
Ligand ID | 5HL |
InChI | InChI=1S/C15H18N2O/c1-2-10-4-3-5-11-8-12(9-16-13-6-7-13)15(18)17-14(10)11/h3-5,8,13,16H,2,6-7,9H2,1H3,(H,17,18) |
InChIKey | NRYCDZCJUHABBD-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | CCc1cccc2c1NC(=O)C(=C2)CNC3CC3 | ACDLabs 12.01 | c3cc2C=C(CNC1CC1)C(Nc2c(CC)c3)=O | CACTVS 3.385 | CCc1cccc2C=C(CNC3CC3)C(=O)Nc12 |
|
Formula | C15 H18 N2 O |
Name | 3-[(cyclopropylamino)methyl]-8-ethylquinolin-2(1H)-one |
ChEMBL | |
DrugBank | |
ZINC | ZINC000013566697
|
PDB chain | 5dq1 Chain A Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|