Structure of PDB 5dpa Chain A Binding Site BS01 |
|
|
Ligand ID | 5F2 |
InChI | InChI=1S/C22H29N3O5/c1-3-30-20(27)10-9-18(14-17-11-12-23-21(17)28)25-22(29)19(24-15(2)26)13-16-7-5-4-6-8-16/h4-10,17-19H,3,11-14H2,1-2H3,(H,23,28)(H,24,26)(H,25,29)/t17-,18+,19-/m0/s1 |
InChIKey | YYPCDXRHVHVVTA-OTWHNJEPSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CCOC(=O)\C=C/[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](Cc2ccccc2)NC(C)=O | OpenEye OEToolkits 1.9.2 | CCOC(=O)C=C[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](Cc2ccccc2)NC(=O)C | CACTVS 3.385 | CCOC(=O)C=C[CH](C[CH]1CCNC1=O)NC(=O)[CH](Cc2ccccc2)NC(C)=O | ACDLabs 12.01 | N2CCC(CC(/C=C\C(=O)OCC)NC(C(NC(C)=O)Cc1ccccc1)=O)C2=O | OpenEye OEToolkits 1.9.2 | CCOC(=O)C=CC(CC1CCNC1=O)NC(=O)C(Cc2ccccc2)NC(=O)C |
|
Formula | C22 H29 N3 O5 |
Name | ethyl (2Z,4S)-4-[(N-acetyl-L-phenylalanyl)amino]-5-[(3S)-2-oxopyrrolidin-3-yl]pent-2-enoate |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5dpa Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|