Structure of PDB 5dhg Chain A Binding Site BS01 |
|
|
Ligand ID | DGV |
InChI | InChI=1S/C26H33Cl2N3O/c27-22-9-4-10-23(28)25(22)21-12-17-30(18-13-21)15-6-14-29-26(32)24-11-5-16-31(24)19-20-7-2-1-3-8-20/h1-4,7-10,21,24H,5-6,11-19H2,(H,29,32)/t24-/m1/s1 |
InChIKey | UWHDLFOAIARROU-XMMPIXPASA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Clc1cccc(Cl)c1[CH]2CCN(CCCNC(=O)[CH]3CCCN3Cc4ccccc4)CC2 | ACDLabs 12.01 | Clc1cccc(Cl)c1C2CCN(CC2)CCCNC(=O)C3CCCN3Cc4ccccc4 | CACTVS 3.385 | Clc1cccc(Cl)c1[C@@H]2CCN(CCCNC(=O)[C@H]3CCCN3Cc4ccccc4)CC2 | OpenEye OEToolkits 1.9.2 | c1ccc(cc1)CN2CCCC2C(=O)NCCCN3CCC(CC3)c4c(cccc4Cl)Cl | OpenEye OEToolkits 1.9.2 | c1ccc(cc1)CN2CCC[C@@H]2C(=O)NCCCN3CCC(CC3)c4c(cccc4Cl)Cl |
|
Formula | C26 H33 Cl2 N3 O |
Name | 1-benzyl-N-{3-[4-(2,6-dichlorophenyl)piperidin-1-yl]propyl}-D-prolinamide |
ChEMBL | CHEMBL1783826 |
DrugBank | |
ZINC | ZINC000071294412
|
PDB chain | 5dhg Chain A Residue 1201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|