Structure of PDB 5dbm Chain A Binding Site BS01 |
|
|
Ligand ID | 58N |
InChI | InChI=1S/C17H22N4O/c1-11-8-15(22)20-14-7-5-6-13(16(14)19-11)12-9-18-21(10-12)17(2,3)4/h5-7,9-11,19H,8H2,1-4H3,(H,20,22)/t11-/m1/s1 |
InChIKey | HPSNXSAYALRMQW-LLVKDONJSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | CC1CC(=O)Nc2cccc(c2N1)c3cnn(c3)C(C)(C)C | CACTVS 3.385 | C[CH]1CC(=O)Nc2cccc(c3cnn(c3)C(C)(C)C)c2N1 | ACDLabs 12.01 | CC(C)(C)n1ncc(c1)c3c2NC(C)CC(=O)Nc2ccc3 | CACTVS 3.385 | C[C@@H]1CC(=O)Nc2cccc(c3cnn(c3)C(C)(C)C)c2N1 | OpenEye OEToolkits 1.9.2 | C[C@@H]1CC(=O)Nc2cccc(c2N1)c3cnn(c3)C(C)(C)C |
|
Formula | C17 H22 N4 O |
Name | (4R)-6-(1-tert-butyl-1H-pyrazol-4-yl)-4-methyl-1,3,4,5-tetrahydro-2H-1,5-benzodiazepin-2-one |
ChEMBL | CHEMBL4207557 |
DrugBank | |
ZINC | ZINC000584905126
|
PDB chain | 5dbm Chain A Residue 1201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|