Structure of PDB 5d6p Chain A Binding Site BS01 |
|
|
Ligand ID | 57U |
InChI | InChI=1S/C11H14N4O2S/c1-2-12-10(17)15-11-14-8(6-16)9(18-11)7-4-3-5-13-7/h3-5,13,16H,2,6H2,1H3,(H2,12,14,15,17) |
InChIKey | YLSYQKDIZQYYGN-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | CCNC(=O)Nc1nc(c(s1)c2ccc[nH]2)CO | ACDLabs 12.01 | c2(sc(c1cccn1)c(CO)n2)NC(=O)NCC | CACTVS 3.385 | CCNC(=O)Nc1sc(c(CO)n1)c2[nH]ccc2 |
|
Formula | C11 H14 N4 O2 S |
Name | 1-ethyl-3-[4-(hydroxymethyl)-5-(1H-pyrrol-2-yl)-1,3-thiazol-2-yl]urea |
ChEMBL | CHEMBL3735431 |
DrugBank | |
ZINC | ZINC000263621285
|
PDB chain | 5d6p Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
5.6.2.2: DNA topoisomerase (ATP-hydrolyzing). |
|
|
|