Structure of PDB 5cy3 Chain A Binding Site BS01 |
|
|
Ligand ID | 55Y |
InChI | InChI=1S/C16H16N4O3S/c1-9(15-6-17-16(21)23-15)22-14-4-10(11-5-18-20(2)7-11)3-13-12(14)8-24-19-13/h3-5,7-9,15H,6H2,1-2H3,(H,17,21)/t9-,15-/m1/s1 |
InChIKey | MKTGBKHCRFUALQ-RFAUZJTJSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | C[C@H]([C@H]1CNC(=O)O1)Oc2cc(cc3c2csn3)c4cnn(c4)C | OpenEye OEToolkits 1.9.2 | CC(C1CNC(=O)O1)Oc2cc(cc3c2csn3)c4cnn(c4)C | CACTVS 3.385 | C[CH](Oc1cc(cc2nscc12)c3cnn(C)c3)[CH]4CNC(=O)O4 | CACTVS 3.385 | C[C@@H](Oc1cc(cc2nscc12)c3cnn(C)c3)[C@H]4CNC(=O)O4 | ACDLabs 12.01 | n4(ncc(c3cc1nscc1c(OC(C2OC(NC2)=O)C)c3)c4)C |
|
Formula | C16 H16 N4 O3 S |
Name | (5R)-5-[(1R)-1-{[6-(1-methyl-1H-pyrazol-4-yl)-2,1-benzothiazol-4-yl]oxy}ethyl]-1,3-oxazolidin-2-one |
ChEMBL | CHEMBL3622209 |
DrugBank | |
ZINC | ZINC000263620750
|
PDB chain | 5cy3 Chain A Residue 701
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|