Structure of PDB 5cxz Chain A Binding Site BS01 |
|
|
Ligand ID | 55U |
InChI | InChI=1S/C19H23N5/c1-24(2)15-8-6-14(7-9-15)17-13-18-16(5-3-11-21-18)19(23-17)22-12-4-10-20/h3,5-9,11,13H,4,10,12,20H2,1-2H3,(H,22,23) |
InChIKey | RIWJHDIYQSQOAT-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | CN(C)c1ccc(cc1)c2cc3c(cccn3)c(n2)NCCCN | CACTVS 3.385 | CN(C)c1ccc(cc1)c2cc3ncccc3c(NCCCN)n2 | ACDLabs 12.01 | c3(c1ccc(N(C)C)cc1)cc2c(cccn2)c(n3)NCCCN |
|
Formula | C19 H23 N5 |
Name | N-{7-[4-(dimethylamino)phenyl]-1,6-naphthyridin-5-yl}propane-1,3-diamine |
ChEMBL | CHEMBL30678 |
DrugBank | |
ZINC | ZINC000003816697
|
PDB chain | 5cxz Chain A Residue 703
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|