Structure of PDB 5cxh Chain A Binding Site BS01 |
|
|
Ligand ID | 55M |
InChI | InChI=1S/C20H21N3O4S/c1-11(13-7-18(24)21-9-13)27-20-19-15(22-10-28-19)8-14(23-20)12-4-5-16(25-2)17(6-12)26-3/h4-6,8,10-11,13H,7,9H2,1-3H3,(H,21,24)/t11-,13-/m1/s1 |
InChIKey | OTUKQYFHRKKGEI-DGCLKSJQSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | C[C@H]([C@@H]1CC(=O)NC1)Oc2c3c(cc(n2)c4ccc(c(c4)OC)OC)ncs3 | ACDLabs 12.01 | c24c(cc(c1cc(c(OC)cc1)OC)nc2OC(C3CNC(C3)=O)C)ncs4 | OpenEye OEToolkits 1.9.2 | CC(C1CC(=O)NC1)Oc2c3c(cc(n2)c4ccc(c(c4)OC)OC)ncs3 | CACTVS 3.385 | COc1ccc(cc1OC)c2cc3ncsc3c(O[C@H](C)[C@H]4CNC(=O)C4)n2 | CACTVS 3.385 | COc1ccc(cc1OC)c2cc3ncsc3c(O[CH](C)[CH]4CNC(=O)C4)n2 |
|
Formula | C20 H21 N3 O4 S |
Name | (4R)-4-[(1R)-1-{[6-(3,4-dimethoxyphenyl)[1,3]thiazolo[5,4-c]pyridin-4-yl]oxy}ethyl]pyrrolidin-2-one |
ChEMBL | CHEMBL3622208 |
DrugBank | |
ZINC | ZINC000263620857
|
PDB chain | 5cxh Chain A Residue 701
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|