Structure of PDB 5ceo Chain A Binding Site BS01 |
|
|
Ligand ID | 50D |
InChI | InChI=1S/C23H26F2N6O/c24-23(25)4-8-31(15-23)22-11-18(17-2-6-30(7-3-17)19-13-32-14-19)10-21(29-22)28-20-9-16(12-26)1-5-27-20/h1,5,9-11,17,19H,2-4,6-8,13-15H2,(H,27,28,29) |
InChIKey | RHFIAUKMKYHHFA-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | FC1(F)CCN(C1)c2cc(cc(Nc3cc(ccn3)C#N)n2)C4CCN(CC4)C5COC5 | OpenEye OEToolkits 1.9.2 | c1cnc(cc1C#N)Nc2cc(cc(n2)N3CCC(C3)(F)F)C4CCN(CC4)C5COC5 |
|
Formula | C23 H26 F2 N6 O |
Name | 2-[[6-[3,3-bis(fluoranyl)pyrrolidin-1-yl]-4-[1-(oxetan-3-yl)piperidin-4-yl]pyridin-2-yl]amino]pyridine-4-carbonitrile |
ChEMBL | CHEMBL3393333 |
DrugBank | |
ZINC | ZINC000207101276
|
PDB chain | 5ceo Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|