Structure of PDB 5c8k Chain A Binding Site BS01 |
|
|
Ligand ID | 4YV |
InChI | InChI=1S/C21H27N7O/c1-29-16-7-10-27(11-8-16)21-22-9-6-19(26-21)25-20-12-18-17(13-23-20)24-14-28(18)15-4-2-3-5-15/h6,9,12-16H,2-5,7-8,10-11H2,1H3,(H,22,23,25,26) |
InChIKey | HVRZVMCNHMWTOQ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | COC1CCN(CC1)c2nccc(n2)Nc3cc4c(cn3)ncn4C5CCCC5 | ACDLabs 12.01 | C1CN(CCC1OC)c2nc(ccn2)Nc4cc3n(cnc3cn4)C5CCCC5 | CACTVS 3.385 | COC1CCN(CC1)c2nccc(Nc3cc4n(cnc4cn3)C5CCCC5)n2 |
|
Formula | C21 H27 N7 O |
Name | 1-cyclopentyl-N-[2-(4-methoxypiperidin-1-yl)pyrimidin-4-yl]-1H-imidazo[4,5-c]pyridin-6-amine |
ChEMBL | CHEMBL3734825 |
DrugBank | |
ZINC | ZINC000222165557
|
PDB chain | 5c8k Chain A Residue 1101
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|