Structure of PDB 5c7y Chain A Binding Site BS01 |
|
|
Ligand ID | ZFR |
InChI | InChI=1S/C17H24O4/c1-13(18)6-5-9-15(19)8-4-2-3-7-14-10-16(20)12-17(21)11-14/h3,7,10-13,18,20-21H,2,4-6,8-9H2,1H3/b7-3+/t13-/m0/s1 |
InChIKey | TVXRLKRGDWQGQV-MXPWBENCSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | C[C@@H](CCCC(=O)CCC/C=C/c1cc(cc(c1)O)O)O | CACTVS 3.385 | C[C@H](O)CCCC(=O)CCC\C=C\c1cc(O)cc(O)c1 | OpenEye OEToolkits 1.9.2 | CC(CCCC(=O)CCCC=Cc1cc(cc(c1)O)O)O | CACTVS 3.385 | C[CH](O)CCCC(=O)CCCC=Cc1cc(O)cc(O)c1 | ACDLabs 12.01 | c1c(O)cc(cc1\C=C\CCCC(=O)CCCC(O)C)O |
|
Formula | C17 H24 O4 |
Name | (1E,10S)-1-(3,5-dihydroxyphenyl)-10-hydroxyundec-1-en-6-one |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584905723
|
PDB chain | 5c7y Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|