Structure of PDB 5byy Chain A Binding Site BS01 |
|
|
Ligand ID | 4WG |
InChI | InChI=1S/C26H30N6O3/c1-4-35-23-15-17(32-13-11-18(33)12-14-32)9-10-20(23)28-26-27-16-22-24(29-26)30(2)21-8-6-5-7-19(21)25(34)31(22)3/h5-10,15-16,18,33H,4,11-14H2,1-3H3,(H,27,28,29) |
InChIKey | QAPAJIZPZGWAND-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | C(Oc1c(ccc(c1)N2CCC(O)CC2)Nc5nc4N(c3ccccc3C(=O)N(C)c4cn5)C)C | CACTVS 3.385 | CCOc1cc(ccc1Nc2ncc3N(C)C(=O)c4ccccc4N(C)c3n2)N5CCC(O)CC5 | OpenEye OEToolkits 1.9.2 | CCOc1cc(ccc1Nc2ncc3c(n2)N(c4ccccc4C(=O)N3C)C)N5CCC(CC5)O |
|
Formula | C26 H30 N6 O3 |
Name | 2-{[2-ethoxy-4-(4-hydroxypiperidin-1-yl)phenyl]amino}-5,11-dimethyl-5,11-dihydro-6H-pyrimido[4,5-b][1,4]benzodiazepin-6-one |
ChEMBL | CHEMBL1673046 |
DrugBank | |
ZINC | ZINC000064633932
|
PDB chain | 5byy Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|