Structure of PDB 5aqt Chain A Binding Site BS01 |
|
|
Ligand ID | 5P7 |
InChI | InChI=1S/C14H17N3O3/c18-6-8-5-11(13(20)12(8)19)17-14-9-3-1-2-4-10(9)15-7-16-14/h1-4,7-8,11-13,18-20H,5-6H2,(H,15,16,17)/t8-,11-,12-,13+/m1/s1 |
InChIKey | CXHFBVLYDOBWST-STRQVWJDSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC[C@H]1C[C@@H](Nc2ncnc3ccccc23)[C@H](O)[C@@H]1O | OpenEye OEToolkits 1.7.6 | c1ccc2c(c1)c(ncn2)N[C@@H]3C[C@@H]([C@H]([C@H]3O)O)CO | OpenEye OEToolkits 1.7.6 | c1ccc2c(c1)c(ncn2)NC3CC(C(C3O)O)CO | CACTVS 3.385 | OC[CH]1C[CH](Nc2ncnc3ccccc23)[CH](O)[CH]1O |
|
Formula | C14 H17 N3 O3 |
Name | (1S,2R,3R,5R)-3-(hydroxymethyl)-5-(quinazolin-4-ylamino)cyclopentane-1,2-diol |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584904772
|
PDB chain | 5aqt Chain A Residue 1381
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|