Structure of PDB 5aqh Chain A Binding Site BS01 |
|
|
Ligand ID | ZVO |
InChI | InChI=1S/C8H8N6/c1-14-8-5-4(6(9)13-14)2-10-7(5)11-3-12-8/h2-3H,1H3,(H2,9,13)(H,10,11,12) |
InChIKey | AJJBAXSCYXENBJ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CN1N=C(N)c2c[nH]c3ncnc1c23 | OpenEye OEToolkits 1.7.6 | CN1c2c3c(c[nH]c3ncn2)C(=N1)N |
|
Formula | C8 H8 N6 |
Name | 5-methyl-1,5-dihydro-1,4,5,6,8-pentaazaacenaphthylen-3-amine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584905718
|
PDB chain | 5aqh Chain A Residue 1382
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|