Structure of PDB 5acc Chain A Binding Site BS01 |
|
|
Ligand ID | KE9 |
InChI | InChI=1S/C25H25F3N2O2/c1-14-10-17-16-6-4-5-7-20(16)29-23(17)24(30(14)13-25(2,3)28)22-18(26)11-15(12-19(22)27)8-9-21(31)32/h4-9,11-12,14,24,29H,10,13H2,1-3H3,(H,31,32)/b9-8+/t14-,24-/m1/s1 |
InChIKey | DFBDRVGWBHBJNR-BBNFHIFMSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | C[C@@H]1Cc2c3ccccc3[nH]c2[C@H](N1CC(C)(C)F)c4c(cc(cc4F)/C=C/C(=O)O)F | CACTVS 3.385 | C[C@@H]1Cc2c([nH]c3ccccc23)[C@H](N1CC(C)(C)F)c4c(F)cc(\C=C\C(O)=O)cc4F | OpenEye OEToolkits 1.7.6 | CC1Cc2c3ccccc3[nH]c2C(N1CC(C)(C)F)c4c(cc(cc4F)C=CC(=O)O)F | CACTVS 3.385 | C[CH]1Cc2c([nH]c3ccccc23)[CH](N1CC(C)(C)F)c4c(F)cc(C=CC(O)=O)cc4F |
|
Formula | C25 H25 F3 N2 O2 |
Name | (E)-3-(3,5-DIFLUORO-4-((1R,3R)-2-(2-FLUORO-2- METHYLPROPYL)-3-METHYL-2,3,4,9-TETRAHYDRO-1H-PYRIDO(3,4-B)INDOL-1-YL)PHENYL)ACRYLIC ACID |
ChEMBL | CHEMBL3623004 |
DrugBank | DB15138 |
ZINC | ZINC000219669733
|
PDB chain | 5acc Chain A Residue 1546
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
Global view | Local view | Structure summary |
[Spin on]
[Spin off]
[Reset]
[High quality]
[Low quality]
[White background]
[Black background]
|
[Spin on]
[Spin off]
[Reset]
[High quality]
[Low quality]
[White background]
[Black background]
|
PDB | 5acc Optimization of a Novel Binding Motif to (E)-3-(3,5-Difluoro-4-((1R,3R)-2-(2-Fluoro-2-Methylpropyl)-3-Methyl-2, 3,4,9-Tetrahydro-1H-Pyrido[3,4-B]Indol-1-Yl)Phenyl)Acrylic Acid (Azd9496), a Potent and Orally Bioavailable Selective Estrogen Receptor Downregulator and Antagonist. |
Resolution | 1.88 Å |
Binding residue (original residue number in PDB) | L346 T347 L349 A350 D351 L384 F404 M421 G521 H524 L525 V534 |
Binding residue (residue number reindexed from 1) | L37 T38 L40 A41 D42 L75 F95 M112 G209 H212 L213 V217 |
Annotation score | 1 |
Binding affinity | MOAD: ic50=0.676nM BindingDB: IC50=0.676083nM |
|
|
Enzyme Commision number |
? |
|
|