Structure of PDB 5a5s Chain A Binding Site BS01 |
|
|
Ligand ID | NP8 |
InChI | InChI=1S/C20H23N5O2/c1-12-7-16-17(13-8-15(27-2)10-22-9-13)11-23-19(18(16)25-20(12)26)24-14-3-5-21-6-4-14/h7-11,14,21H,3-6H2,1-2H3,(H,23,24)(H,25,26) |
InChIKey | FPQQERRFPULCIK-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COc1cncc(c1)c2cnc(NC3CCNCC3)c4NC(=O)C(=Cc24)C | OpenEye OEToolkits 1.7.6 | CC1=Cc2c(cnc(c2NC1=O)NC3CCNCC3)c4cc(cnc4)OC |
|
Formula | C20 H23 N5 O2 |
Name | 5-(5-methoxypyridin-3-yl)-3-methyl-8-[(piperidin-4-yl)amino]-1,2-dihydro-1,7-naphthyridin-2-one |
ChEMBL | CHEMBL3585455 |
DrugBank | |
ZINC | ZINC000263620429
|
PDB chain | 5a5s Chain A Residue 1170
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|