Structure of PDB 4zy4 Chain A Binding Site BS01 |
|
|
Ligand ID | 4T3 |
InChI | InChI=1S/C17H21N7S/c18-11-3-6-24(7-4-11)17-19-12-5-8-25-15(12)16(21-17)20-14-9-13(22-23-14)10-1-2-10/h5,8-11H,1-4,6-7,18H2,(H2,19,20,21,22,23) |
InChIKey | DNTNKJATBLJMII-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | c1csc2c1nc(nc2Nc3cc([nH]n3)C4CC4)N5CCC(CC5)N | CACTVS 3.385 | NC1CCN(CC1)c2nc(Nc3cc([nH]n3)C4CC4)c5sccc5n2 | ACDLabs 12.01 | c23c(nc(N1CCC(CC1)N)nc2ccs3)Nc5cc(C4CC4)nn5 |
|
Formula | C17 H21 N7 S |
Name | 2-(4-aminopiperidin-1-yl)-N-(5-cyclopropyl-1H-pyrazol-3-yl)thieno[3,2-d]pyrimidin-4-amine |
ChEMBL | CHEMBL3580949 |
DrugBank | |
ZINC | ZINC000263620369
|
PDB chain | 4zy4 Chain A Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|