Structure of PDB 4zsm Chain A Binding Site BS01 |
|
|
Ligand ID | 4RW |
InChI | InChI=1S/C8H14N2S/c9-8-10-7-4-2-1-3-6(7)5-11-8/h6-7H,1-5H2,(H2,9,10)/t6-,7-/m1/s1 |
InChIKey | SZAFVQHJBWFBIQ-RNFRBKRXSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | C12CSC(N)=NC1CCCC2 | CACTVS 3.385 | NC1=N[CH]2CCCC[CH]2CS1 | OpenEye OEToolkits 1.9.2 | C1CC[C@@H]2[C@H](C1)CSC(=N2)N | OpenEye OEToolkits 1.9.2 | C1CCC2C(C1)CSC(=N2)N | CACTVS 3.385 | NC1=N[C@@H]2CCCC[C@@H]2CS1 |
|
Formula | C8 H14 N2 S |
Name | (4aS,8aR)-4a,5,6,7,8,8a-hexahydro-4H-3,1-benzothiazin-2-amine |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 4zsm Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|