Structure of PDB 4zsj Chain A Binding Site BS01 |
|
|
Ligand ID | 4R0 |
InChI | InChI=1S/C13H17ClN6O/c1-7(2)16-13(21)20-12(18-11(15)19-20)17-9-4-5-10(14)8(3)6-9/h4-7H,1-3H3,(H,16,21)(H3,15,17,18,19) |
InChIKey | HSFMSVIZAIBADX-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | Cc1cc(ccc1Cl)Nc2nc(nn2C(=O)NC(C)C)N | CACTVS 3.385 | CC(C)NC(=O)n1nc(N)nc1Nc2ccc(Cl)c(C)c2 | ACDLabs 12.01 | c2(cc(Nc1nc(nn1C(NC(C)C)=O)N)ccc2Cl)C |
|
Formula | C13 H17 Cl N6 O |
Name | 3-amino-5-[(4-chloro-3-methylphenyl)amino]-N-(propan-2-yl)-1H-1,2,4-triazole-1-carboxamide |
ChEMBL | CHEMBL5201485 |
DrugBank | |
ZINC | ZINC000584904893
|
PDB chain | 4zsj Chain A Residue 405
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|