Structure of PDB 4z93 Chain A Binding Site BS01 |
|
|
Ligand ID | 4LD |
InChI | InChI=1S/C24H23N5O2/c1-11-21(23(28-27-11)14-5-6-14)24-22-15-10-19(30-4)16(20-12(2)29-31-13(20)3)9-18(15)26-17(22)7-8-25-24/h7-10,14,26H,5-6H2,1-4H3,(H,27,28) |
InChIKey | WHDUHJYPRJXLGF-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COc1cc2c([nH]c3ccnc(c4c(C)[nH]nc4C5CC5)c23)cc1c6c(C)onc6C | ACDLabs 12.01 | COc4cc2c1c(nccc1nc2cc4c3c(C)onc3C)c5c(nnc5C6CC6)C | OpenEye OEToolkits 1.9.2 | Cc1c(c(n[nH]1)C2CC2)c3c4c(ccn3)[nH]c5c4cc(c(c5)c6c(noc6C)C)OC |
|
Formula | C24 H23 N5 O2 |
Name | 1-(3-cyclopropyl-5-methyl-1H-pyrazol-4-yl)-7-(3,5-dimethyl-1,2-oxazol-4-yl)-8-methoxy-5H-pyrido[4,3-b]indole |
ChEMBL | CHEMBL3581661 |
DrugBank | |
ZINC | ZINC000212275034
|
PDB chain | 4z93 Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|