Structure of PDB 4z0k Chain A Binding Site BS01 |
|
|
Ligand ID | 4LN |
InChI | InChI=1S/C22H22N6O2/c1-14-3-8-19(29)20-17-11-22(2,10-9-18(17)26-28(14)20)25-21(30)15-4-6-16(7-5-15)27-12-23-24-13-27/h3-8,12-13,29H,9-11H2,1-2H3,(H,25,30)/t22-/m1/s1 |
InChIKey | GHULVZIKWFGNRE-JOCHJYFZSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1ccc(O)c2n1nc3CC[C@](C)(Cc23)NC(=O)c4ccc(cc4)n5cnnc5 | ACDLabs 12.01 | O=C(NC2(Cc1c3n(nc1CC2)c(ccc3O)C)C)c5ccc(n4cnnc4)cc5 | OpenEye OEToolkits 1.9.2 | Cc1ccc(c2n1nc3c2CC(CC3)(C)NC(=O)c4ccc(cc4)n5cnnc5)O | OpenEye OEToolkits 1.9.2 | Cc1ccc(c2n1nc3c2C[C@](CC3)(C)NC(=O)c4ccc(cc4)n5cnnc5)O | CACTVS 3.385 | Cc1ccc(O)c2n1nc3CC[C](C)(Cc23)NC(=O)c4ccc(cc4)n5cnnc5 |
|
Formula | C22 H22 N6 O2 |
Name | N-[(2R)-10-hydroxy-2,7-dimethyl-1,2,3,4-tetrahydropyrido[1,2-b]indazol-2-yl]-4-(4H-1,2,4-triazol-4-yl)benzamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000263620462
|
PDB chain | 4z0k Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|