Structure of PDB 4ytc Chain A Binding Site BS01 |
|
|
Ligand ID | 4HW |
InChI | InChI=1S/C18H16N8/c19-17-24-18(23-14-9-5-2-6-10-14)25-26(17)16-11-15(20-12-21-16)22-13-7-3-1-4-8-13/h1-12H,(H,20,21,22)(H3,19,23,24,25) |
InChIKey | PYFLNUFSEAXOHE-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | c1cc(ccc1)Nc2cc(ncn2)n3c(N)nc(n3)Nc4ccccc4 | OpenEye OEToolkits 1.9.2 | c1ccc(cc1)Nc2cc(ncn2)n3c(nc(n3)Nc4ccccc4)N | CACTVS 3.385 | Nc1nc(Nc2ccccc2)nn1c3cc(Nc4ccccc4)ncn3 |
|
Formula | C18 H16 N8 |
Name | N~3~-phenyl-1-[6-(phenylamino)pyrimidin-4-yl]-1H-1,2,4-triazole-3,5-diamine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000200578944
|
PDB chain | 4ytc Chain A Residue 4000
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|