Structure of PDB 4yqo Chain A Binding Site BS01 |
|
|
Ligand ID | 4H1 |
InChI | InChI=1S/C14H22N4O/c15-7-10-2-1-3-11(6-10)8-17-13-5-4-12(9-18-13)14(16)19/h4-5,9-11H,1-3,6-8,15H2,(H2,16,19)(H,17,18)/t10-,11+/m0/s1 |
InChIKey | UUTSJGSKPMLQOF-WDEREUQCSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | c1c(cnc(c1)NCC2CCCC(C2)CN)C(N)=O | OpenEye OEToolkits 1.9.2 | c1cc(ncc1C(=O)N)NC[C@@H]2CCC[C@@H](C2)CN | OpenEye OEToolkits 1.9.2 | c1cc(ncc1C(=O)N)NCC2CCCC(C2)CN | CACTVS 3.385 | NC[C@H]1CCC[C@@H](CNc2ccc(cn2)C(N)=O)C1 | CACTVS 3.385 | NC[CH]1CCC[CH](CNc2ccc(cn2)C(N)=O)C1 |
|
Formula | C14 H22 N4 O |
Name | 6-({[(1R,3S)-3-(aminomethyl)cyclohexyl]methyl}amino)pyridine-3-carboxamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000311876079
|
PDB chain | 4yqo Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
P89 E116 R154 |
Catalytic site (residue number reindexed from 1) |
P97 E124 R162 |
Enzyme Commision number |
2.1.1.228: tRNA (guanine(37)-N(1))-methyltransferase. |
|
|
|