Structure of PDB 4yqn Chain A Binding Site BS01 |
|
|
Ligand ID | 4H3 |
InChI | InChI=1S/C12H17N3O3/c13-12(18)7-1-2-11(14-5-7)15-9-3-8(6-16)10(17)4-9/h1-2,5,8-10,16-17H,3-4,6H2,(H2,13,18)(H,14,15)/t8-,9-,10+/m1/s1 |
InChIKey | OOPBXYPWRQVSFZ-BBBLOLIVSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | c1cc(ncc1C(=O)N)N[C@@H]2C[C@@H]([C@H](C2)O)CO | CACTVS 3.385 | NC(=O)c1ccc(N[CH]2C[CH](O)[CH](CO)C2)nc1 | CACTVS 3.385 | NC(=O)c1ccc(N[C@H]2C[C@H](O)[C@@H](CO)C2)nc1 | OpenEye OEToolkits 1.9.2 | c1cc(ncc1C(=O)N)NC2CC(C(C2)O)CO | ACDLabs 12.01 | c1c(cnc(c1)NC2CC(C(C2)O)CO)C(N)=O |
|
Formula | C12 H17 N3 O3 |
Name | 6-{[(1R,3S,4R)-3-hydroxy-4-(hydroxymethyl)cyclopentyl]amino}pyridine-3-carboxamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584904998
|
PDB chain | 4yqn Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
P89 E116 R154 |
Catalytic site (residue number reindexed from 1) |
P92 E119 R157 |
Enzyme Commision number |
2.1.1.228: tRNA (guanine(37)-N(1))-methyltransferase. |
|
|
|