Structure of PDB 4yq8 Chain A Binding Site BS01 |
|
|
Ligand ID | 4FV |
InChI | InChI=1S/C8H12N4O3/c9-7-6(11-15-12-7)8(14)10-4-1-2-5(13)3-4/h4-5,13H,1-3H2,(H2,9,12)(H,10,14)/t4-,5+/m1/s1 |
InChIKey | UDKGUOUTPCVPOO-UHNVWZDZSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | C1CC(CC1NC(=O)c2c(non2)N)O | OpenEye OEToolkits 1.9.2 | C1C[C@@H](C[C@@H]1NC(=O)c2c(non2)N)O | CACTVS 3.385 | Nc1nonc1C(=O)N[CH]2CC[CH](O)C2 | CACTVS 3.385 | Nc1nonc1C(=O)N[C@@H]2CC[C@H](O)C2 | ACDLabs 12.01 | c1(c(non1)N)C(=O)NC2CCC(C2)O |
|
Formula | C8 H12 N4 O3 |
Name | 4-amino-N-[(1R,3S)-3-hydroxycyclopentyl]-1,2,5-oxadiazole-3-carboxamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584905039
|
PDB chain | 4yq8 Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
P89 E116 R154 |
Catalytic site (residue number reindexed from 1) |
P91 E118 R156 |
Enzyme Commision number |
2.1.1.228: tRNA (guanine(37)-N(1))-methyltransferase. |
|
|
|