Structure of PDB 4ymb Chain A Binding Site BS01 |
|
|
Ligand ID | 4E7 |
InChI | InChI=1S/C15H19NO4/c1-2-4-11-8-16-13(15(19)20)12(11)9-5-3-6-10(7-9)14(17)18/h3,5-7,11-13,16H,2,4,8H2,1H3,(H,17,18)(H,19,20)/t11-,12+,13+/m1/s1 |
InChIKey | OORLOXOWCACWSS-AGIUHOORSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | CCCC1CNC(C1c2cccc(c2)C(=O)O)C(=O)O | CACTVS 3.385 | CCC[C@@H]1CN[C@@H]([C@H]1c2cccc(c2)C(O)=O)C(O)=O | ACDLabs 12.01 | N1C(C(C(C1)CCC)c2cc(ccc2)C(=O)O)C(O)=O | OpenEye OEToolkits 1.9.2 | CCC[C@@H]1CN[C@@H]([C@H]1c2cccc(c2)C(=O)O)C(=O)O | CACTVS 3.385 | CCC[CH]1CN[CH]([CH]1c2cccc(c2)C(O)=O)C(O)=O |
|
Formula | C15 H19 N O4 |
Name | (3R,4S)-3-(3-carboxyphenyl)-4-propyl-L-proline |
ChEMBL | |
DrugBank | |
ZINC | ZINC000263620853
|
PDB chain | 4ymb Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|