Structure of PDB 4ykt Chain A Binding Site BS01 |
|
|
Ligand ID | 4EQ |
InChI | InChI=1S/C19H17ClN4O5S/c20-13-7-16(18(26)8-17(13)25)24-15-4-3-11(6-14(15)23-19(24)27)9-22-30(28,29)12-2-1-5-21-10-12/h1-8,10,22,25-26,28-29H,9H2,(H,23,27) |
InChIKey | SQXCHUIGGIEAOA-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Oc1cc(O)c(cc1Cl)N2C(=O)Nc3cc(CN[S](O)(O)c4cccnc4)ccc23 | OpenEye OEToolkits 1.9.2 | c1cc(cnc1)S(NCc2ccc3c(c2)NC(=O)N3c4cc(c(cc4O)O)Cl)(O)O | ACDLabs 12.01 | OS(O)(c1cnccc1)NCc2cc3c(cc2)N(C(N3)=O)c4cc(Cl)c(cc4O)O |
|
Formula | C19 H17 Cl N4 O5 S |
Name | 1-(5-chloro-2,4-dihydroxyphenyl)-5-({[dihydroxy(pyridin-3-yl)-lambda~4~-sulfanyl]amino}methyl)-1,3-dihydro-2H-benzimidazol-2-one |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584905032
|
PDB chain | 4ykt Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.6.4.10: non-chaperonin molecular chaperone ATPase. |
|
|
|