Structure of PDB 4yjo Chain A Binding Site BS01 |
|
|
Ligand ID | 4DF |
InChI | InChI=1S/C20H18ClN7O2S/c1-2-28(17-5-3-4-16-14(17)10-23-27-16)19-15(21)11-22-20(26-19)25-13-7-6-12-9-24-31(29,30)18(12)8-13/h3-8,10-11,24H,2,9H2,1H3,(H,23,27)(H,22,25,26) |
InChIKey | XZUGISDIVDJNBC-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CCN(c1cccc2[nH]ncc12)c3nc(Nc4ccc5CN[S](=O)(=O)c5c4)ncc3Cl | ACDLabs 12.01 | CCN(c3nc(Nc2ccc1CNS(=O)(c1c2)=O)ncc3Cl)c4cccc5c4cnn5 | OpenEye OEToolkits 1.9.2 | CCN(c1cccc2c1cn[nH]2)c3c(cnc(n3)Nc4ccc5c(c4)S(=O)(=O)NC5)Cl |
|
Formula | C20 H18 Cl N7 O2 S |
Name | 5-chloro-N~2~-(1,1-dioxido-2,3-dihydro-1,2-benzothiazol-6-yl)-N~4~-ethyl-N~4~-(1H-indazol-4-yl)pyrimidine-2,4-diamine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000034838103
|
PDB chain | 4yjo Chain A Residue 701
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|