Structure of PDB 4y8c Chain A Binding Site BS01 |
|
|
Ligand ID | 49D |
InChI | InChI=1S/C18H20ClN5O/c1-11(12-6-8-13(19)9-7-12)21-18-22-16-15(17(25)23-18)10-20-24(16)14-4-2-3-5-14/h6-11,14H,2-5H2,1H3,(H2,21,22,23,25)/t11-/m0/s1 |
InChIKey | FIUCLBJMUGCQTF-NSHDSACASA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | Clc1ccc(cc1)C(NC2=Nc3c(C(=O)N2)cnn3C4CCCC4)C | CACTVS 3.385 | C[C@H](NC1=Nc2n(ncc2C(=O)N1)C3CCCC3)c4ccc(Cl)cc4 | OpenEye OEToolkits 1.9.2 | CC(c1ccc(cc1)Cl)NC2=Nc3c(cnn3C4CCCC4)C(=O)N2 | CACTVS 3.385 | C[CH](NC1=Nc2n(ncc2C(=O)N1)C3CCCC3)c4ccc(Cl)cc4 | OpenEye OEToolkits 1.9.2 | C[C@@H](c1ccc(cc1)Cl)NC2=Nc3c(cnn3C4CCCC4)C(=O)N2 |
|
Formula | C18 H20 Cl N5 O |
Name | 6-{[(1S)-1-(4-chlorophenyl)ethyl]amino}-1-cyclopentyl-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one |
ChEMBL | CHEMBL5285855 |
DrugBank | |
ZINC | ZINC000263620419
|
PDB chain | 4y8c Chain A Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.1.4.35: 3',5'-cyclic-GMP phosphodiesterase. |
|
|
|