Structure of PDB 4y5n Chain A Binding Site BS01 |
|
|
Ligand ID | 487 |
InChI | InChI=1S/C13H24N6/c1-10(19-8-6-4-5-7-9-19)11-15-12(14)17-13(16-11)18(2)3/h10H,4-9H2,1-3H3,(H2,14,15,16,17)/t10-/m0/s1 |
InChIKey | VXAHGJQOHMSESG-JTQLQIEISA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | CC(c1nc(nc(n1)N(C)C)N)N2CCCCCC2 | OpenEye OEToolkits 1.9.2 | C[C@@H](c1nc(nc(n1)N(C)C)N)N2CCCCCC2 | CACTVS 3.385 | C[CH](N1CCCCCC1)c2nc(N)nc(n2)N(C)C | CACTVS 3.385 | C[C@H](N1CCCCCC1)c2nc(N)nc(n2)N(C)C | ACDLabs 12.01 | n1c(nc(nc1C(N2CCCCCC2)C)N(C)C)N |
|
Formula | C13 H24 N6 |
Name | 6-[(1S)-1-(azepan-1-yl)ethyl]-N,N-dimethyl-1,3,5-triazine-2,4-diamine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000009722332
|
PDB chain | 4y5n Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|