Structure of PDB 4y5h Chain A Binding Site BS01 |
|
|
Ligand ID | 519 |
InChI | InChI=1S/C20H30N6O2/c1-12(2)22-20(28)24-16-8-6-15(7-9-16)23-19-21-11-14-5-10-17(27)26(13(3)4)18(14)25-19/h5,10-13,15-16H,6-9H2,1-4H3,(H,21,23,25)(H2,22,24,28)/t15-,16- |
InChIKey | FJVVBMGXZMJPOI-WKILWMFISA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(C)NC(=O)N[CH]1CC[CH](CC1)Nc2ncc3C=CC(=O)N(C(C)C)c3n2 | CACTVS 3.385 | CC(C)NC(=O)N[C@@H]1CC[C@H](CC1)Nc2ncc3C=CC(=O)N(C(C)C)c3n2 | ACDLabs 12.01 | CC(C)NC(=O)NC1CCC(CC1)Nc2nc3c(cn2)C=CC(=O)N3C(C)C | OpenEye OEToolkits 1.9.2 | CC(C)NC(=O)NC1CCC(CC1)Nc2ncc3c(n2)N(C(=O)C=C3)C(C)C |
|
Formula | C20 H30 N6 O2 |
Name | 1-(trans-4-{[7-oxo-8-(propan-2-yl)-7,8-dihydropyrido[2,3-d]pyrimidin-2-yl]amino}cyclohexyl)-3-propan-2-ylurea |
ChEMBL | CHEMBL3577868 |
DrugBank | |
ZINC |
|
PDB chain | 4y5h Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|